C8H15NNaO5S+ — CID 20522571
sodium 2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]ethanesulfonic acid (PubChem CID 20522571) has the molecular formula C8H15NNaO5S+ and a molecular weight of 260.27 g/mol. Its IUPAC name is sodium 2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]ethanesulfonic acid.
| Compound Name | sodium 2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 20522571 |
| Molecular Formula | C8H15NNaO5S+ |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | sodium 2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]ethanesulfonic acid |
| SMILES | CCOC(=O)/C=C(\C)NCCS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C8H15NO5S.Na/c1-3-14-8(10)6-7(2)9-4-5-15(11,12)13;/h6,9H,3-5H2,1-2H3,(H,11,12,13);/q;+1/b7-6+; |
| InChIKey | IFFIHTSXUXWROA-UHDJGPCESA-N |
| XLogP | -3.07 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|