C9H16NNaO5 — CID 173434114
sodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoic acid;hydride (PubChem CID 173434114) has the molecular formula C9H16NNaO5 and a molecular weight of 241.22 g/mol. Its IUPAC name is sodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoic acid;hydride.
| Compound Name | sodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoic acid;hydride |
|---|---|
| PubChem CID | 173434114 |
| Molecular Formula | C9H16NNaO5 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | sodium;(2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoic acid;hydride |
| SMILES | CCOC(=O)/C=C(\C)N[C@@H](CO)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C9H15NO5.Na.H/c1-3-15-8(12)4-6(2)10-7(5-11)9(13)14;;/h4,7,10-11H,3,5H2,1-2H3,(H,13,14);;/q;+1;-1/b6-4+;;/t7-;;/m0../s1 |
| InChIKey | GITFIQZEBPVFBN-OJLYELGUSA-N |
| XLogP | -3.40 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|