C10H17NO5 — CID 88753259
(2S,3R)-2-[(4-ethoxy-4-oxobut-2-en-2-yl)amino]-3-hydroxybutanoic acid (PubChem CID 88753259) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S,3R)-2-[(4-ethoxy-4-oxobut-2-en-2-yl)amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(4-ethoxy-4-oxobut-2-en-2-yl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 88753259 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2S,3R)-2-[(4-ethoxy-4-oxobut-2-en-2-yl)amino]-3-hydroxybutanoic acid |
| SMILES | CCOC(=O)C=C(C)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C10H17NO5/c1-4-16-8(13)5-6(2)11-9(7(3)12)10(14)15/h5,7,9,11-12H,4H2,1-3H3,(H,14,15)/t7-,9+/m1/s1 |
| InChIKey | OCKMRPWILCATNK-APPZFPTMSA-N |
| XLogP | -0.12 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|