C9H14KNO5 — CID 23709840
potassium (2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoate (PubChem CID 23709840) has the molecular formula C9H14KNO5 and a molecular weight of 255.31 g/mol. Its IUPAC name is potassium (2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoate.
| Compound Name | potassium (2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 23709840 |
| Molecular Formula | C9H14KNO5 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | potassium (2S)-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)/C=C(\C)N[C@@H](CO)C(=O)[O-].[K+] |
| InChI | InChI=1S/C9H15NO5.K/c1-3-15-8(12)4-6(2)10-7(5-11)9(13)14;/h4,7,10-11H,3,5H2,1-2H3,(H,13,14);/q;+1/p-1/b6-4+;/t7-;/m0./s1 |
| InChIKey | SSMZBZYJSYDDGW-TXYWNESVSA-M |
| XLogP | -4.84 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|