C14H18NNaO4 — CID 56842845
sodium (2R)-2-cyclohexa-1,4-dien-1-yl-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetate (PubChem CID 56842845) has the molecular formula C14H18NNaO4 and a molecular weight of 287.29 g/mol. Its IUPAC name is sodium (2R)-2-cyclohexa-1,4-dien-1-yl-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetate.
| Compound Name | sodium (2R)-2-cyclohexa-1,4-dien-1-yl-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetate |
|---|---|
| PubChem CID | 56842845 |
| Molecular Formula | C14H18NNaO4 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | sodium (2R)-2-cyclohexa-1,4-dien-1-yl-2-[[(E)-4-ethoxy-4-oxobut-2-en-2-yl]amino]acetate |
| SMILES | CCOC(=O)/C=C(\C)N[C@@H](C(=O)[O-])C1=CCC=CC1.[Na+] |
| InChI | InChI=1S/C14H19NO4.Na/c1-3-19-12(16)9-10(2)15-13(14(17)18)11-7-5-4-6-8-11;/h4-5,8-9,13,15H,3,6-7H2,1-2H3,(H,17,18);/q;+1/p-1/b10-9+;/t13-;/m1./s1 |
| InChIKey | JGPJVJHNIHGNNG-VMEHJNRZSA-M |
| XLogP | -2.56 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|