C16H24N2O6S — CID 9003804
4-methoxy-N-(3-methoxypropyl)-3-(morpholine-4-carbonyl)benzenesulfonamide (PubChem CID 9003804) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is 4-methoxy-N-(3-methoxypropyl)-3-(morpholine-4-carbonyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(3-methoxypropyl)-3-(morpholine-4-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9003804 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-methoxy-N-(3-methoxypropyl)-3-(morpholine-4-carbonyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(OC)c(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H24N2O6S/c1-22-9-3-6-17-25(20,21)13-4-5-15(23-2)14(12-13)16(19)18-7-10-24-11-8-18/h4-5,12,17H,3,6-11H2,1-2H3 |
| InChIKey | FGGWPIAPTMKHFB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|