C23H21ClN6O2 — CID 90038114
3-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-(oxetan-3-ylamino)quinoxaline-6-carbonitrile (PubChem CID 90038114) has the molecular formula C23H21ClN6O2 and a molecular weight of 448.91 g/mol. Its IUPAC name is 3-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-(oxetan-3-ylamino)quinoxaline-6-carbonitrile.
| Compound Name | 3-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-(oxetan-3-ylamino)quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 90038114 |
| Molecular Formula | C23H21ClN6O2 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-(oxetan-3-ylamino)quinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(NC3COC3)c(N3CCN(C(=O)c4ccc(Cl)cc4)CC3)nc2c1 |
| InChI | InChI=1S/C23H21ClN6O2/c24-17-4-2-16(3-5-17)23(31)30-9-7-29(8-10-30)22-21(26-18-13-32-14-18)27-19-6-1-15(12-25)11-20(19)28-22/h1-6,11,18H,7-10,13-14H2,(H,26,27) |
| InChIKey | STTZUEMATWZIFZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |