C17H16ClN5O — CID 133284104
3-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]pyrazine-2-carbonitrile (PubChem CID 133284104) has the molecular formula C17H16ClN5O and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284104 |
| Molecular Formula | C17H16ClN5O |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-[4-(4-chlorobenzoyl)-1,4-diazepan-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H16ClN5O/c18-14-4-2-13(3-5-14)17(24)23-9-1-8-22(10-11-23)16-15(12-19)20-6-7-21-16/h2-7H,1,8-11H2 |
| InChIKey | UFKLBHDWDVUZET-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |