C16H17ClN4O — CID 122132459
(4-chlorophenyl)-(4-pyrazin-2-yl-1,4-diazepan-1-yl)methanone (PubChem CID 122132459) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is (4-chlorophenyl)-(4-pyrazin-2-yl-1,4-diazepan-1-yl)methanone.
| Compound Name | (4-chlorophenyl)-(4-pyrazin-2-yl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 122132459 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (4-chlorophenyl)-(4-pyrazin-2-yl-1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C16H17ClN4O/c17-14-4-2-13(3-5-14)16(22)21-9-1-8-20(10-11-21)15-12-18-6-7-19-15/h2-7,12H,1,8-11H2 |
| InChIKey | IIKXEIWOSGVBQJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |