C22H22ClN5O4S — CID 129042924
[4-(4-pyrazin-2-ylpiperazine-1-carbonyl)anilino] 5-chloro-2-methoxybenzenesulfinate (PubChem CID 129042924) has the molecular formula C22H22ClN5O4S and a molecular weight of 487.97 g/mol. Its IUPAC name is [4-(4-pyrazin-2-ylpiperazine-1-carbonyl)anilino] 5-chloro-2-methoxybenzenesulfinate.
| Compound Name | [4-(4-pyrazin-2-ylpiperazine-1-carbonyl)anilino] 5-chloro-2-methoxybenzenesulfinate |
|---|---|
| PubChem CID | 129042924 |
| Molecular Formula | C22H22ClN5O4S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [4-(4-pyrazin-2-ylpiperazine-1-carbonyl)anilino] 5-chloro-2-methoxybenzenesulfinate |
| SMILES | COc1ccc(Cl)cc1S(=O)ONc1ccc(C(=O)N2CCN(c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C22H22ClN5O4S/c1-31-19-7-4-17(23)14-20(19)33(30)32-26-18-5-2-16(3-6-18)22(29)28-12-10-27(11-13-28)21-15-24-8-9-25-21/h2-9,14-15,26H,10-13H2,1H3 |
| InChIKey | BMWVZGQAJJWTTI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|