C22H19F3N4O4 — CID 90039800
N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide (PubChem CID 90039800) has the molecular formula C22H19F3N4O4 and a molecular weight of 460.41 g/mol. Its IUPAC name is N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide.
| Compound Name | N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 90039800 |
| Molecular Formula | C22H19F3N4O4 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
| SMILES | O=C(NC1(c2ccc(OC(F)(F)F)cc2)CCOc2cccnc21)c1cc2n(n1)CCCO2 |
| InChI | InChI=1S/C22H19F3N4O4/c23-22(24,25)33-15-6-4-14(5-7-15)21(8-12-31-17-3-1-9-26-19(17)21)27-20(30)16-13-18-29(28-16)10-2-11-32-18/h1,3-7,9,13H,2,8,10-12H2,(H,27,30) |
| InChIKey | BURNPMMSMPYJIR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |