C24H23F3N4O3 — CID 90039749
2-methyl-N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 90039749) has the molecular formula C24H23F3N4O3 and a molecular weight of 472.47 g/mol. Its IUPAC name is 2-methyl-N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 2-methyl-N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 90039749 |
| Molecular Formula | C24H23F3N4O3 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-methyl-N-[4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | Cn1nc2c(c1C(=O)NC1(c3ccc(OC(F)(F)F)cc3)CCOc3cccnc31)CCCC2 |
| InChI | InChI=1S/C24H23F3N4O3/c1-31-20(17-5-2-3-6-18(17)30-31)22(32)29-23(12-14-33-19-7-4-13-28-21(19)23)15-8-10-16(11-9-15)34-24(25,26)27/h4,7-11,13H,2-3,5-6,12,14H2,1H3,(H,29,32) |
| InChIKey | UMEZSNRNZMZVNK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |