About (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol
(4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol (PubChem CID 129388315) has the molecular formula C15H12F3NO3
and a molecular weight of 311.26 g/mol. Its IUPAC name is (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol.
Molecular Properties
| Compound Name | (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol |
| PubChem CID | 129388315 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol |
| SMILES | O[C@@]1(c2ccc(OC(F)(F)F)cc2)CCOc2cccnc21 |
| InChI | InChI=1S/C15H12F3NO3/c16-15(17,18)22-11-5-3-10(4-6-11)14(20)7-9-21-12-2-1-8-19-13(12)14/h1-6,8,20H,7,9H2/t14-/m1/s1 |
| InChIKey | IHVXAAHVLUJSRI-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol?
The IUPAC name of (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol (CID 129388315) is (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol.
What is the SMILES notation for (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol?
The canonical SMILES for (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol is O[C@@]1(c2ccc(OC(F)(F)F)cc2)CCOc2cccnc21.
What is the InChIKey of (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol?
The InChIKey is IHVXAAHVLUJSRI-CQSZACIVSA-N. The full InChI is InChI=1S/C15H12F3NO3/c16-15(17,18)22-11-5-3-10(4-6-11)14(20)7-9-21-12-2-1-8-19-13(12)14/h1-6,8,20H,7,9H2/t14-/m1/s1.
What are the key properties of (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol?
(4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol has a molecular weight of 311.26 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[4-(trifluoromethoxy)phenyl]-2,3-dihydropyrano[3,2-b]pyridin-4-ol is sourced from PubChem (CID 129388315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).