C32H24N8 — CID 90046118
5,8-bis(3-imidazo[1,2-a]pyridin-2-ylphenyl)-6,7-dihydropteridine (PubChem CID 90046118) has the molecular formula C32H24N8 and a molecular weight of 520.60 g/mol. Its IUPAC name is 5,8-bis(3-imidazo[1,2-a]pyridin-2-ylphenyl)-6,7-dihydropteridine.
| Compound Name | 5,8-bis(3-imidazo[1,2-a]pyridin-2-ylphenyl)-6,7-dihydropteridine |
|---|---|
| PubChem CID | 90046118 |
| Molecular Formula | C32H24N8 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 5,8-bis(3-imidazo[1,2-a]pyridin-2-ylphenyl)-6,7-dihydropteridine |
| SMILES | c1cc(-c2cn3ccccc3n2)cc(N2CCN(c3cccc(-c4cn5ccccc5n4)c3)c3ncncc32)c1 |
| InChI | InChI=1S/C32H24N8/c1-3-13-37-20-27(35-30(37)11-1)23-7-5-9-25(17-23)39-15-16-40(32-29(39)19-33-22-34-32)26-10-6-8-24(18-26)28-21-38-14-4-2-12-31(38)36-28/h1-14,17-22H,15-16H2 |
| InChIKey | MVKSSEQQMFQLEK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 66.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|