C22H16F3N5O3S — CID 90047695
3-[[5-(6-phenyl-1,3-benzothiazole-2-carbonyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]pyrrolidin-2-one (PubChem CID 90047695) has the molecular formula C22H16F3N5O3S and a molecular weight of 487.46 g/mol. Its IUPAC name is 3-[[5-(6-phenyl-1,3-benzothiazole-2-carbonyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]pyrrolidin-2-one.
| Compound Name | 3-[[5-(6-phenyl-1,3-benzothiazole-2-carbonyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90047695 |
| Molecular Formula | C22H16F3N5O3S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 3-[[5-(6-phenyl-1,3-benzothiazole-2-carbonyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]pyrrolidin-2-one |
| SMILES | O=C(c1nnc(N(CC(F)(F)F)C2CCNC2=O)o1)c1nc2ccc(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C22H16F3N5O3S/c23-22(24,25)11-30(15-8-9-26-18(15)32)21-29-28-19(33-21)17(31)20-27-14-7-6-13(10-16(14)34-20)12-4-2-1-3-5-12/h1-7,10,15H,8-9,11H2,(H,26,32) |
| InChIKey | NSCFODDTHRJGOC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |