C28H24N4O2S — CID 118473106
[5-[1-(4-methylphenyl)piperidin-4-yl]-1,3,4-oxadiazol-2-yl]-(6-phenyl-1,3-benzothiazol-2-yl)methanone (PubChem CID 118473106) has the molecular formula C28H24N4O2S and a molecular weight of 480.59 g/mol. Its IUPAC name is [5-[1-(4-methylphenyl)piperidin-4-yl]-1,3,4-oxadiazol-2-yl]-(6-phenyl-1,3-benzothiazol-2-yl)methanone.
| Compound Name | [5-[1-(4-methylphenyl)piperidin-4-yl]-1,3,4-oxadiazol-2-yl]-(6-phenyl-1,3-benzothiazol-2-yl)methanone |
|---|---|
| PubChem CID | 118473106 |
| Molecular Formula | C28H24N4O2S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [5-[1-(4-methylphenyl)piperidin-4-yl]-1,3,4-oxadiazol-2-yl]-(6-phenyl-1,3-benzothiazol-2-yl)methanone |
| SMILES | Cc1ccc(N2CCC(c3nnc(C(=O)c4nc5ccc(-c6ccccc6)cc5s4)o3)CC2)cc1 |
| InChI | InChI=1S/C28H24N4O2S/c1-18-7-10-22(11-8-18)32-15-13-20(14-16-32)26-30-31-27(34-26)25(33)28-29-23-12-9-21(17-24(23)35-28)19-5-3-2-4-6-19/h2-12,17,20H,13-16H2,1H3 |
| InChIKey | SHUCUKFIQRTGIQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|