C18H14N4O4S2 — CID 118322778
2-(6-phenyl-1,3-benzothiazole-2-carbonyl)-5-[(1R)-1-(sulfinoamino)ethyl]-1,3,4-oxadiazole (PubChem CID 118322778) has the molecular formula C18H14N4O4S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-(6-phenyl-1,3-benzothiazole-2-carbonyl)-5-[(1R)-1-(sulfinoamino)ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(6-phenyl-1,3-benzothiazole-2-carbonyl)-5-[(1R)-1-(sulfinoamino)ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 118322778 |
| Molecular Formula | C18H14N4O4S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 2-(6-phenyl-1,3-benzothiazole-2-carbonyl)-5-[(1R)-1-(sulfinoamino)ethyl]-1,3,4-oxadiazole |
| SMILES | C[C@@H](NS(=O)O)c1nnc(C(=O)c2nc3ccc(-c4ccccc4)cc3s2)o1 |
| InChI | InChI=1S/C18H14N4O4S2/c1-10(22-28(24)25)16-20-21-17(26-16)15(23)18-19-13-8-7-12(9-14(13)27-18)11-5-3-2-4-6-11/h2-10,22H,1H3,(H,24,25)/t10-/m1/s1 |
| InChIKey | XOQLEKMGQBFGGD-SNVBAGLBSA-N |
| XLogP | 3.36 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|