C26H33F2NO2 — CID 90048504
benzyl N-[(1S,3R)-1-(3,3-difluorocyclohexyl)-3-phenylhexyl]carbamate (PubChem CID 90048504) has the molecular formula C26H33F2NO2 and a molecular weight of 429.55 g/mol. Its IUPAC name is benzyl N-[(1S,3R)-1-(3,3-difluorocyclohexyl)-3-phenylhexyl]carbamate.
| Compound Name | benzyl N-[(1S,3R)-1-(3,3-difluorocyclohexyl)-3-phenylhexyl]carbamate |
|---|---|
| PubChem CID | 90048504 |
| Molecular Formula | C26H33F2NO2 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | benzyl N-[(1S,3R)-1-(3,3-difluorocyclohexyl)-3-phenylhexyl]carbamate |
| SMILES | CCCC(C[C@H](NC(=O)OCc1ccccc1)C1CCCC(F)(F)C1)c1ccccc1 |
| InChI | InChI=1S/C26H33F2NO2/c1-2-10-22(21-13-7-4-8-14-21)17-24(23-15-9-16-26(27,28)18-23)29-25(30)31-19-20-11-5-3-6-12-20/h3-8,11-14,22-24H,2,9-10,15-19H2,1H3,(H,29,30)/t22?,23?,24-/m0/s1 |
| InChIKey | MGHWYCNCJZGXSP-VHYCJAOWSA-N |
| XLogP | 7.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |