C28H36N2O2 — CID 90051578
2-(4-ethylcyclohexyl)oxy-7-[1-[4-(1-hydroxyethenyl)piperidin-1-yl]ethyl]naphthalene-1-carbonitrile (PubChem CID 90051578) has the molecular formula C28H36N2O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 2-(4-ethylcyclohexyl)oxy-7-[1-[4-(1-hydroxyethenyl)piperidin-1-yl]ethyl]naphthalene-1-carbonitrile.
| Compound Name | 2-(4-ethylcyclohexyl)oxy-7-[1-[4-(1-hydroxyethenyl)piperidin-1-yl]ethyl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90051578 |
| Molecular Formula | C28H36N2O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 2-(4-ethylcyclohexyl)oxy-7-[1-[4-(1-hydroxyethenyl)piperidin-1-yl]ethyl]naphthalene-1-carbonitrile |
| SMILES | C=C(O)C1CCN(C(C)c2ccc3ccc(OC4CCC(CC)CC4)c(C#N)c3c2)CC1 |
| InChI | InChI=1S/C28H36N2O2/c1-4-21-5-10-25(11-6-21)32-28-12-9-23-7-8-24(17-26(23)27(28)18-29)19(2)30-15-13-22(14-16-30)20(3)31/h7-9,12,17,19,21-22,25,31H,3-6,10-11,13-16H2,1-2H3 |
| InChIKey | KJKMEBFYRDQHSN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|