C16H21N7O7S — CID 90055730
5-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxysulfanylmethyl]imidazolidine-2,4-dione (PubChem CID 90055730) has the molecular formula C16H21N7O7S and a molecular weight of 455.45 g/mol. Its IUPAC name is 5-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxysulfanylmethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxysulfanylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90055730 |
| Molecular Formula | C16H21N7O7S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxysulfanylmethyl]imidazolidine-2,4-dione |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COSCC2NC(=O)NC2=O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C16H21N7O7S/c1-16(27)9(24)7(3-29-31-4-6-11(25)21-15(26)19-6)30-13(16)23-5-18-8-10(23)20-14(17)22-12(8)28-2/h5-7,9,13,24,27H,3-4H2,1-2H3,(H2,17,20,22)(H2,19,21,25,26)/t6?,7-,9-,13-,16-/m1/s1 |
| InChIKey | LYVOWJUYZOMZAI-SDGLDGIBSA-N |
| XLogP | -1.70 |
| TPSA | 195.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|