C18H15ClFN3O2 — CID 90056260
CID 90056260 (PubChem CID 90056260) has the molecular formula C18H15ClFN3O2 and a molecular weight of 359.79 g/mol.
| Compound Name | CID 90056260 |
|---|---|
| PubChem CID | 90056260 |
| Molecular Formula | C18H15ClFN3O2 |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | — |
| SMILES | NC1=NC2(CO1)c1cc(-c3cc(Cl)cnc3F)ccc1OCC21CC1 |
| InChI | InChI=1S/C18H15ClFN3O2/c19-11-6-12(15(20)22-7-11)10-1-2-14-13(5-10)18(9-25-16(21)23-18)17(3-4-17)8-24-14/h1-2,5-7H,3-4,8-9H2,(H2,21,23) |
| InChIKey | YLFDDYWNYJPIAU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|