C21H25FN8 — CID 90066581
4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-N-[(E)-1-iminobut-2-en-2-yl]-8-N-methyl-9H-pyrimido[4,5-b]indole-2,8-diamine (PubChem CID 90066581) has the molecular formula C21H25FN8 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-N-[(E)-1-iminobut-2-en-2-yl]-8-N-methyl-9H-pyrimido[4,5-b]indole-2,8-diamine.
| Compound Name | 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-N-[(E)-1-iminobut-2-en-2-yl]-8-N-methyl-9H-pyrimido[4,5-b]indole-2,8-diamine |
|---|---|
| PubChem CID | 90066581 |
| Molecular Formula | C21H25FN8 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[(1R,4R,5R)-5-amino-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-2-N-[(E)-1-iminobut-2-en-2-yl]-8-N-methyl-9H-pyrimido[4,5-b]indole-2,8-diamine |
| SMILES | [H]/N=C/C(=C\C)Nc1nc(N2C[C@H]3C[C@@H]2C[C@H]3N)c2c(n1)[nH]c1c(NC)cc(F)cc12 |
| InChI | InChI=1S/C21H25FN8/c1-3-12(8-23)26-21-28-19-17(14-5-11(22)6-16(25-2)18(14)27-19)20(29-21)30-9-10-4-13(30)7-15(10)24/h3,5-6,8,10,13,15,23,25H,4,7,9,24H2,1-2H3,(H2,26,27,28,29)/b12-3+,23-8+/t10-,13-,15-/m1/s1 |
| InChIKey | CFZVEIZKKXQMII-LBEMQLDPSA-N |
| XLogP | 3.18 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|