C40H86O19S — CID 90068233
1-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]hexane;1-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-hexoxyethanol;sulfuric acid (PubChem CID 90068233) has the molecular formula C40H86O19S and a molecular weight of 903.18 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]hexane;1-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-hexoxyethanol;sulfuric acid.
| Compound Name | 1-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]hexane;1-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-hexoxyethanol;sulfuric acid |
|---|---|
| PubChem CID | 90068233 |
| Molecular Formula | C40H86O19S |
| Molecular Weight | 903.18 g/mol |
| Exact Mass | 902.55 |
| IUPAC Name | 1-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]hexane;1-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-2-hexoxyethanol;sulfuric acid |
| SMILES | CCCCCCOCC(O)OCCOCCOCCOCCOCCOCC.CCCCCCOCCOCCOCCOCCOCCOCCOCC.O=S(=O)(O)O |
| InChI | InChI=1S/C20H42O8.C20H42O7.H2O4S/c1-3-5-6-7-8-27-19-20(21)28-18-17-26-16-15-25-14-13-24-12-11-23-10-9-22-4-2;1-3-5-6-7-8-22-11-12-24-15-16-26-19-20-27-18-17-25-14-13-23-10-9-21-4-2;1-5(2,3)4/h20-21H,3-19H2,1-2H3;3-20H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | IDOPXUWMNAPVSY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 224.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|