C9H11N7O4 — CID 90071738
2-[4-[(5-nitroimidazol-1-yl)methyl]triazol-1-yl]-3-nitrosopropan-1-ol (PubChem CID 90071738) has the molecular formula C9H11N7O4 and a molecular weight of 281.23 g/mol. Its IUPAC name is 2-[4-[(5-nitroimidazol-1-yl)methyl]triazol-1-yl]-3-nitrosopropan-1-ol.
| Compound Name | 2-[4-[(5-nitroimidazol-1-yl)methyl]triazol-1-yl]-3-nitrosopropan-1-ol |
|---|---|
| PubChem CID | 90071738 |
| Molecular Formula | C9H11N7O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[4-[(5-nitroimidazol-1-yl)methyl]triazol-1-yl]-3-nitrosopropan-1-ol |
| SMILES | O=NCC(CO)n1cc(Cn2cncc2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C9H11N7O4/c17-5-8(1-11-18)15-4-7(12-13-15)3-14-6-10-2-9(14)16(19)20/h2,4,6,8,17H,1,3,5H2 |
| InChIKey | CMWNAZVPTRMRRL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|