C22H20N2O3 — CID 9007221
(2S)-2-(2,4-dihydroxyphenyl)-3-(2-phenylethyl)-1,2-dihydroquinazolin-4-one (PubChem CID 9007221) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2S)-2-(2,4-dihydroxyphenyl)-3-(2-phenylethyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-(2,4-dihydroxyphenyl)-3-(2-phenylethyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9007221 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (2S)-2-(2,4-dihydroxyphenyl)-3-(2-phenylethyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@H](c2ccc(O)cc2O)N1CCc1ccccc1 |
| InChI | InChI=1S/C22H20N2O3/c25-16-10-11-18(20(26)14-16)21-23-19-9-5-4-8-17(19)22(27)24(21)13-12-15-6-2-1-3-7-15/h1-11,14,21,23,25-26H,12-13H2/t21-/m0/s1 |
| InChIKey | JWRNCMRBWGSGIP-NRFANRHFSA-N |
| XLogP | 3.91 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|