C11H15N3O4S2 — CID 90073674
N-methoxy-2-[[2-[2-(methoxyamino)-2-oxoethyl]sulfanyl-3-pyridinyl]sulfanyl]acetamide (PubChem CID 90073674) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-methoxy-2-[[2-[2-(methoxyamino)-2-oxoethyl]sulfanyl-3-pyridinyl]sulfanyl]acetamide.
| Compound Name | N-methoxy-2-[[2-[2-(methoxyamino)-2-oxoethyl]sulfanyl-3-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 90073674 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-methoxy-2-[[2-[2-(methoxyamino)-2-oxoethyl]sulfanyl-3-pyridinyl]sulfanyl]acetamide |
| SMILES | CONC(=O)CSc1cccnc1SCC(=O)NOC |
| InChI | InChI=1S/C11H15N3O4S2/c1-17-13-9(15)6-19-8-4-3-5-12-11(8)20-7-10(16)14-18-2/h3-5H,6-7H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | CPHNXIBITIPSIR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|