C12H13F3O3 — CID 90074115
[(2S,5R)-5-[4-(trifluoromethoxy)phenyl]oxolan-2-yl]methanol (PubChem CID 90074115) has the molecular formula C12H13F3O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is [(2S,5R)-5-[4-(trifluoromethoxy)phenyl]oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-[4-(trifluoromethoxy)phenyl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 90074115 |
| Molecular Formula | C12H13F3O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [(2S,5R)-5-[4-(trifluoromethoxy)phenyl]oxolan-2-yl]methanol |
| SMILES | OC[C@@H]1CC[C@H](c2ccc(OC(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C12H13F3O3/c13-12(14,15)18-9-3-1-8(2-4-9)11-6-5-10(7-16)17-11/h1-4,10-11,16H,5-7H2/t10-,11+/m0/s1 |
| InChIKey | IYKLONJWMUMPTN-WDEREUQCSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |