C19H29NO4 — CID 90074186
2,5-bis(2-ethenoxypentoxy)pyridine (PubChem CID 90074186) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 2,5-bis(2-ethenoxypentoxy)pyridine.
| Compound Name | 2,5-bis(2-ethenoxypentoxy)pyridine |
|---|---|
| PubChem CID | 90074186 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2,5-bis(2-ethenoxypentoxy)pyridine |
| SMILES | C=COC(CCC)COc1ccc(OCC(CCC)OC=C)nc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-9-17(21-7-3)14-23-16-11-12-19(20-13-16)24-15-18(10-6-2)22-8-4/h7-8,11-13,17-18H,3-6,9-10,14-15H2,1-2H3 |
| InChIKey | MTFJMPJLOBIRBE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|