C16H13NO — CID 90074627
bicyclo[3.1.0]hexa-1(6),2,4-triene;N-phenylbut-3-ynamide (PubChem CID 90074627) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;N-phenylbut-3-ynamide.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N-phenylbut-3-ynamide |
|---|---|
| PubChem CID | 90074627 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;N-phenylbut-3-ynamide |
| SMILES | C#CCC(=O)Nc1ccccc1.c1cc2cc-2c1 |
| InChI | InChI=1S/C10H9NO.C6H4/c1-2-6-10(12)11-9-7-4-3-5-8-9;1-2-5-4-6(5)3-1/h1,3-5,7-8H,6H2,(H,11,12);1-4H |
| InChIKey | ZYDXHZJTBBASKS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|