C21H22N2O3 — CID 9007582
(2R)-3-(1,3-benzodioxol-5-yl)-2-cyclohexyl-1,2-dihydroquinazolin-4-one (PubChem CID 9007582) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-3-(1,3-benzodioxol-5-yl)-2-cyclohexyl-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(1,3-benzodioxol-5-yl)-2-cyclohexyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9007582 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2R)-3-(1,3-benzodioxol-5-yl)-2-cyclohexyl-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](C2CCCCC2)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H22N2O3/c24-21-16-8-4-5-9-17(16)22-20(14-6-2-1-3-7-14)23(21)15-10-11-18-19(12-15)26-13-25-18/h4-5,8-12,14,20,22H,1-3,6-7,13H2/t20-/m1/s1 |
| InChIKey | NPPWDFMSRMGNBK-HXUWFJFHSA-N |
| XLogP | 4.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |