C14H18FNO — CID 90077861
(1R,2R)-6-fluoro-1-piperidin-1-yl-2,3-dihydro-1H-inden-2-ol (PubChem CID 90077861) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is (1R,2R)-6-fluoro-1-piperidin-1-yl-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2R)-6-fluoro-1-piperidin-1-yl-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 90077861 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (1R,2R)-6-fluoro-1-piperidin-1-yl-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@@H]1Cc2ccc(F)cc2[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C14H18FNO/c15-11-5-4-10-8-13(17)14(12(10)9-11)16-6-2-1-3-7-16/h4-5,9,13-14,17H,1-3,6-8H2/t13-,14-/m1/s1 |
| InChIKey | SRKHSIJQCRUCOS-ZIAGYGMSSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |