C14H19FN2 — CID 9169081
(4S)-7-fluoro-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 9169081) has the molecular formula C14H19FN2 and a molecular weight of 234.32 g/mol. Its IUPAC name is (4S)-7-fluoro-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (4S)-7-fluoro-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 9169081 |
| Molecular Formula | C14H19FN2 |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (4S)-7-fluoro-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Fc1ccc2c(c1)CNC[C@H]2N1CCCCC1 |
| InChI | InChI=1S/C14H19FN2/c15-12-4-5-13-11(8-12)9-16-10-14(13)17-6-2-1-3-7-17/h4-5,8,14,16H,1-3,6-7,9-10H2/t14-/m1/s1 |
| InChIKey | JJZLGJMTDIPKML-CQSZACIVSA-N |
| XLogP | 2.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |