C19H31N3 — CID 9170280
(4S)-4-(azepan-1-yl)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 9170280) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (4S)-4-(azepan-1-yl)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | (4S)-4-(azepan-1-yl)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 9170280 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (4S)-4-(azepan-1-yl)-N,N-diethyl-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | CCN(CC)c1ccc2c(c1)CNC[C@H]2N1CCCCCC1 |
| InChI | InChI=1S/C19H31N3/c1-3-21(4-2)17-9-10-18-16(13-17)14-20-15-19(18)22-11-7-5-6-8-12-22/h9-10,13,19-20H,3-8,11-12,14-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | RVFBWPGLEDZUMP-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|