C15H23N3 — CID 9170181
(4R)-N,N-dimethyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 9170181) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is (4R)-N,N-dimethyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | (4R)-N,N-dimethyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 9170181 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | (4R)-N,N-dimethyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | CN(C)c1ccc2c(c1)CNC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C15H23N3/c1-17(2)13-5-6-14-12(9-13)10-16-11-15(14)18-7-3-4-8-18/h5-6,9,15-16H,3-4,7-8,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | JPVANGSUNMFMPT-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|