C16H25N3 — CID 9170189
(4R)-N,N-dimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 9170189) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (4R)-N,N-dimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | (4R)-N,N-dimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 9170189 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (4R)-N,N-dimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | CN(C)c1ccc2c(c1)CNC[C@@H]2N1CCCCC1 |
| InChI | InChI=1S/C16H25N3/c1-18(2)14-6-7-15-13(10-14)11-17-12-16(15)19-8-4-3-5-9-19/h6-7,10,16-17H,3-5,8-9,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | RURMQQWFRQLYAW-INIZCTEOSA-N |
| XLogP | 2.38 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|