C23H30ClN5O3 — CID 90077948
(3aR,5R,6aR)-3a-(3-chloro-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl)-5-[(3-methoxyoxan-4-yl)amino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonitrile (PubChem CID 90077948) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is (3aR,5R,6aR)-3a-(3-chloro-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl)-5-[(3-methoxyoxan-4-yl)amino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonitrile.
| Compound Name | (3aR,5R,6aR)-3a-(3-chloro-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl)-5-[(3-methoxyoxan-4-yl)amino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 90077948 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (3aR,5R,6aR)-3a-(3-chloro-7,8-dihydro-5H-1,6-naphthyridine-6-carbonyl)-5-[(3-methoxyoxan-4-yl)amino]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carbonitrile |
| SMILES | COC1COCCC1N[C@@H]1C[C@H]2CN(C#N)C[C@@]2(C(=O)N2CCc3ncc(Cl)cc3C2)C1 |
| InChI | InChI=1S/C23H30ClN5O3/c1-31-21-12-32-5-3-20(21)27-18-7-16-11-28(14-25)13-23(16,8-18)22(30)29-4-2-19-15(10-29)6-17(24)9-26-19/h6,9,16,18,20-21,27H,2-5,7-8,10-13H2,1H3/t16-,18+,20?,21?,23-/m0/s1 |
| InChIKey | DEZXRNAKCRPXCT-MBCHPUNESA-N |
| XLogP | 1.57 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|