C10H13N7 — CID 90078494
N-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]-2H-tetrazol-5-amine (PubChem CID 90078494) has the molecular formula C10H13N7 and a molecular weight of 231.26 g/mol. Its IUPAC name is N-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 90078494 |
| Molecular Formula | C10H13N7 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N-methyl-N-[(E)-[4-(methylamino)phenyl]methylideneamino]-2H-tetrazol-5-amine |
| SMILES | CNc1ccc(/C=N/N(C)c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C10H13N7/c1-11-9-5-3-8(4-6-9)7-12-17(2)10-13-15-16-14-10/h3-7,11H,1-2H3,(H,13,14,15,16)/b12-7+ |
| InChIKey | UFFGQLOIKFLVLM-KPKJPENVSA-N |
| XLogP | 0.71 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|