About 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate
4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate (PubChem CID 90079893) has the molecular formula C24H26ClF3O4
and a molecular weight of 470.92 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate |
| PubChem CID | 90079893 |
| Molecular Formula | C24H26ClF3O4 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate |
| SMILES | CC(C)(C)OC(=O)C(c1ccc(Cl)cc1)C(CCC(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H26ClF3O4/c1-23(2,3)32-22(30)20(17-9-11-18(25)12-10-17)19(13-14-24(26,27)28)21(29)31-15-16-7-5-4-6-8-16/h4-12,19-20H,13-15H2,1-3H3 |
| InChIKey | CYALAVRGUOIXQE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate?
The IUPAC name of 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate (CID 90079893) is 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate?
The canonical SMILES for 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate is CC(C)(C)OC(=O)C(c1ccc(Cl)cc1)C(CCC(F)(F)F)C(=O)OCc1ccccc1.
What is the InChIKey of 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate?
The InChIKey is CYALAVRGUOIXQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClF3O4/c1-23(2,3)32-22(30)20(17-9-11-18(25)12-10-17)19(13-14-24(26,27)28)21(29)31-15-16-7-5-4-6-8-16/h4-12,19-20H,13-15H2,1-3H3.
What are the key properties of 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate?
4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate has a molecular weight of 470.92 g/mol, XLogP of 6.47, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-tert-butyl 2-(4-chlorophenyl)-3-(3,3,3-trifluoropropyl)butanedioate is sourced from PubChem (CID 90079893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).