C21H19ClFN2O5S- — CID 90080942
6-[2-chloro-5-fluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-(2-hydroxyethoxy)quinoline (PubChem CID 90080942) has the molecular formula C21H19ClFN2O5S- and a molecular weight of 465.91 g/mol. Its IUPAC name is 6-[2-chloro-5-fluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-(2-hydroxyethoxy)quinoline.
| Compound Name | 6-[2-chloro-5-fluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-(2-hydroxyethoxy)quinoline |
|---|---|
| PubChem CID | 90080942 |
| Molecular Formula | C21H19ClFN2O5S- |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 6-[2-chloro-5-fluoro-3-[3-(sulfinatoamino)propyl]benzoyl]-3-(2-hydroxyethoxy)quinoline |
| SMILES | O=C(c1ccc2ncc(OCCO)cc2c1)c1cc(F)cc(CCCNS(=O)[O-])c1Cl |
| InChI | InChI=1S/C21H20ClFN2O5S/c22-20-13(2-1-5-25-31(28)29)9-16(23)11-18(20)21(27)14-3-4-19-15(8-14)10-17(12-24-19)30-7-6-26/h3-4,8-12,25-26H,1-2,5-7H2,(H,28,29)/p-1 |
| InChIKey | JRYAITYRXBXZBZ-UHFFFAOYSA-M |
| XLogP | 2.95 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|