C25H34BN2O3 — CID 90084774
CID 90084774 (PubChem CID 90084774) has the molecular formula C25H34BN2O3 and a molecular weight of 421.37 g/mol.
| Compound Name | CID 90084774 |
|---|---|
| PubChem CID | 90084774 |
| Molecular Formula | C25H34BN2O3 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | — |
| SMILES | COc1ccc([C@@H](C)N2CCC[C@H]2c2cncc([B]C3OC(C)(C)C(C)(C)O3)c2)cc1 |
| InChI | InChI=1S/C25H34BN2O3/c1-17(18-9-11-21(29-6)12-10-18)28-13-7-8-22(28)19-14-20(16-27-15-19)26-23-30-24(2,3)25(4,5)31-23/h9-12,14-17,22-23H,7-8,13H2,1-6H3/t17-,22+/m1/s1 |
| InChIKey | WBYSOCBVIWQGLS-VGSWGCGISA-N |
| XLogP | 4.21 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|