C20H29NO4 — CID 71661666
[(3aS,4S,8Z,9aR)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]methanol (PubChem CID 71661666) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3aS,4S,8Z,9aR)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]methanol.
| Compound Name | [(3aS,4S,8Z,9aR)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]methanol |
|---|---|
| PubChem CID | 71661666 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(3aS,4S,8Z,9aR)-5-[(1R)-1-(4-methoxyphenyl)ethyl]-2,2-dimethyl-4,6,7,9a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]azocin-4-yl]methanol |
| SMILES | COc1ccc([C@@H](C)N2CC/C=C\[C@H]3OC(C)(C)O[C@H]3[C@@H]2CO)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-14(15-8-10-16(23-4)11-9-15)21-12-6-5-7-18-19(17(21)13-22)25-20(2,3)24-18/h5,7-11,14,17-19,22H,6,12-13H2,1-4H3/b7-5-/t14-,17+,18-,19+/m1/s1 |
| InChIKey | BREMWPAVHHOKCB-UWOCEFEQSA-N |
| XLogP | 2.90 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|