C39H30N10O4S2 — CID 90086424
3-[[6-anilino-3-cyano-5-[[3-cyano-5-phenyldiazenyl-4-[3-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]-4-methyl-2-pyridinyl]amino]benzenesulfonic acid (PubChem CID 90086424) has the molecular formula C39H30N10O4S2 and a molecular weight of 766.87 g/mol. Its IUPAC name is 3-[[6-anilino-3-cyano-5-[[3-cyano-5-phenyldiazenyl-4-[3-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]-4-methyl-2-pyridinyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[6-anilino-3-cyano-5-[[3-cyano-5-phenyldiazenyl-4-[3-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]-4-methyl-2-pyridinyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 90086424 |
| Molecular Formula | C39H30N10O4S2 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | 3-[[6-anilino-3-cyano-5-[[3-cyano-5-phenyldiazenyl-4-[3-(propanoylamino)phenyl]thiophen-2-yl]diazenyl]-4-methyl-2-pyridinyl]amino]benzenesulfonic acid |
| SMILES | CCC(=O)Nc1cccc(-c2c(/N=N/c3ccccc3)sc(/N=N/c3c(Nc4ccccc4)nc(Nc4cccc(S(=O)(=O)O)c4)c(C#N)c3C)c2C#N)c1 |
| InChI | InChI=1S/C39H30N10O4S2/c1-3-33(50)42-28-17-10-12-25(20-28)34-32(23-41)38(54-39(34)49-46-27-15-8-5-9-16-27)48-47-35-24(2)31(22-40)36(45-37(35)43-26-13-6-4-7-14-26)44-29-18-11-19-30(21-29)55(51,52)53/h4-21H,3H2,1-2H3,(H,42,50)(H2,43,44,45)(H,51,52,53)/b48-47+,49-46+ |
| InChIKey | VDZCRDNKFAABGO-YORQSWJQSA-N |
| XLogP | 10.78 |
| TPSA | 217.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|