C20H38O9 — CID 90087132
1-butoxy-3-[(2R,4R)-4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]-2-methoxy-5-methyloxan-3-yl]oxypropan-2-ol (PubChem CID 90087132) has the molecular formula C20H38O9 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-butoxy-3-[(2R,4R)-4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]-2-methoxy-5-methyloxan-3-yl]oxypropan-2-ol.
| Compound Name | 1-butoxy-3-[(2R,4R)-4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]-2-methoxy-5-methyloxan-3-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 90087132 |
| Molecular Formula | C20H38O9 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-butoxy-3-[(2R,4R)-4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]-2-methoxy-5-methyloxan-3-yl]oxypropan-2-ol |
| SMILES | CCCCOCC(O)COC1[C@H](OC)OCC(C)[C@H]1OCC(O)COCC1CO1 |
| InChI | InChI=1S/C20H38O9/c1-4-5-6-24-8-15(21)11-28-19-18(14(2)7-29-20(19)23-3)27-10-16(22)9-25-12-17-13-26-17/h14-22H,4-13H2,1-3H3/t14?,15?,16?,17?,18-,19?,20-/m1/s1 |
| InChIKey | OYFCLFICQSWTRM-WXGAXUPLSA-N |
| XLogP | 0.35 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|