C13H21BNO2 — CID 90089006
CID 90089006 (PubChem CID 90089006) has the molecular formula C13H21BNO2 and a molecular weight of 234.13 g/mol.
| Compound Name | CID 90089006 |
|---|---|
| PubChem CID | 90089006 |
| Molecular Formula | C13H21BNO2 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | — |
| SMILES | CNc1ccc([B]OC(C)(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C13H21BNO2/c1-12(2,16)13(3,4)17-14-10-6-8-11(15-5)9-7-10/h6-9,15-16H,1-5H3 |
| InChIKey | AXLOYKSFGDRJEG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|