C40H58O2 — CID 90094147
[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] icosa-2,4,6,8,10-pentaenoate (PubChem CID 90094147) has the molecular formula C40H58O2 and a molecular weight of 570.90 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] icosa-2,4,6,8,10-pentaenoate.
| Compound Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] icosa-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 90094147 |
| Molecular Formula | C40H58O2 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.44 |
| IUPAC Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] icosa-2,4,6,8,10-pentaenoate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H58O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-39(41)42-34-32-36(3)27-24-26-35(2)30-31-38-37(4)28-25-33-40(38,5)6/h15-24,26-27,29-32H,7-14,25,28,33-34H2,1-6H3 |
| InChIKey | SDBOXWHZMUACPT-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|