C25H26FN5O — CID 90094406
N-[3-(dimethylamino)propyl]-7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 90094406) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90094406 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | Cc1cc(-c2ncccc2-c2ccn3c(C(=O)NCCCN(C)C)ncc3c2)ccc1F |
| InChI | InChI=1S/C25H26FN5O/c1-17-14-19(7-8-22(17)26)23-21(6-4-10-27-23)18-9-13-31-20(15-18)16-29-24(31)25(32)28-11-5-12-30(2)3/h4,6-10,13-16H,5,11-12H2,1-3H3,(H,28,32) |
| InChIKey | XWOFPHQEMQFBPN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|