C30H26FN3O4 — CID 90095106
5-[2-(4-cyanophenyl)-6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-1-oxoisoquinolin-3-yl]pentanoic acid (PubChem CID 90095106) has the molecular formula C30H26FN3O4 and a molecular weight of 511.55 g/mol. Its IUPAC name is 5-[2-(4-cyanophenyl)-6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-1-oxoisoquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-cyanophenyl)-6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-1-oxoisoquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 90095106 |
| Molecular Formula | C30H26FN3O4 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 5-[2-(4-cyanophenyl)-6-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-1-oxoisoquinolin-3-yl]pentanoic acid |
| SMILES | C[C@@H](NC(=O)c1ccc2c(=O)n(-c3ccc(C#N)cc3)c(CCCCC(=O)O)cc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26FN3O4/c1-19(21-8-11-24(31)12-9-21)33-29(37)22-10-15-27-23(16-22)17-26(4-2-3-5-28(35)36)34(30(27)38)25-13-6-20(18-32)7-14-25/h6-17,19H,2-5H2,1H3,(H,33,37)(H,35,36)/t19-/m1/s1 |
| InChIKey | GERCAPRDMLSXBV-LJQANCHMSA-N |
| XLogP | 5.29 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|