C32H31F2N3O4 — CID 90095410
5-[2-(4-fluorophenyl)-6-[(2R)-4-(4-fluorophenyl)-2-methylpiperazine-1-carbonyl]-1-oxoisoquinolin-3-yl]pentanoic acid (PubChem CID 90095410) has the molecular formula C32H31F2N3O4 and a molecular weight of 559.61 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-6-[(2R)-4-(4-fluorophenyl)-2-methylpiperazine-1-carbonyl]-1-oxoisoquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-fluorophenyl)-6-[(2R)-4-(4-fluorophenyl)-2-methylpiperazine-1-carbonyl]-1-oxoisoquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 90095410 |
| Molecular Formula | C32H31F2N3O4 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-6-[(2R)-4-(4-fluorophenyl)-2-methylpiperazine-1-carbonyl]-1-oxoisoquinolin-3-yl]pentanoic acid |
| SMILES | C[C@@H]1CN(c2ccc(F)cc2)CCN1C(=O)c1ccc2c(=O)n(-c3ccc(F)cc3)c(CCCCC(=O)O)cc2c1 |
| InChI | InChI=1S/C32H31F2N3O4/c1-21-20-35(26-11-7-24(33)8-12-26)16-17-36(21)31(40)22-6-15-29-23(18-22)19-28(4-2-3-5-30(38)39)37(32(29)41)27-13-9-25(34)10-14-27/h6-15,18-19,21H,2-5,16-17,20H2,1H3,(H,38,39)/t21-/m1/s1 |
| InChIKey | YTMWEJHKTHDECR-OAQYLSRUSA-N |
| XLogP | 5.42 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|