C30H26FN3O5 — CID 90095975
5-[2-(4-fluorophenyl)-1-oxo-6-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)carbamoyl]isoquinolin-3-yl]pentanoic acid (PubChem CID 90095975) has the molecular formula C30H26FN3O5 and a molecular weight of 527.55 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)-1-oxo-6-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)carbamoyl]isoquinolin-3-yl]pentanoic acid.
| Compound Name | 5-[2-(4-fluorophenyl)-1-oxo-6-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)carbamoyl]isoquinolin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 90095975 |
| Molecular Formula | C30H26FN3O5 |
| Molecular Weight | 527.55 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 5-[2-(4-fluorophenyl)-1-oxo-6-[(2-oxo-3,4-dihydro-1H-quinolin-4-yl)carbamoyl]isoquinolin-3-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1cc2cc(C(=O)NC3CC(=O)Nc4ccccc43)ccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C30H26FN3O5/c31-20-10-12-21(13-11-20)34-22(5-1-4-8-28(36)37)16-19-15-18(9-14-23(19)30(34)39)29(38)33-26-17-27(35)32-25-7-3-2-6-24(25)26/h2-3,6-7,9-16,26H,1,4-5,8,17H2,(H,32,35)(H,33,38)(H,36,37) |
| InChIKey | HPLQSJVMVJAUFE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|