C17H9F3N4 — CID 90095643
7-[2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 90095643) has the molecular formula C17H9F3N4 and a molecular weight of 326.28 g/mol. Its IUPAC name is 7-[2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90095643 |
| Molecular Formula | C17H9F3N4 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 7-[2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Fc1cc(-c2ncccc2-c2ccn3ncnc3c2)cc(F)c1F |
| InChI | InChI=1S/C17H9F3N4/c18-13-6-11(7-14(19)16(13)20)17-12(2-1-4-21-17)10-3-5-24-15(8-10)22-9-23-24/h1-9H |
| InChIKey | YHJHPIANKNNDNW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|